Compound Q&A

What are the physical and chemical properties of ((1,3,5-Triazine-2,4,6-triyl)tris(benzene-4,1-diyl))triboronic acid (CAS: 910231-21-9)?

Answer

((1,3,5-Triazine-2,4,6-triyl)tris(benzene-4,1-diyl))triboronic acid
((1,3,5-Triazine-2,4,6-triyl)tris(benzene-4,1-diyl))triboronic acid is a crystalline solid with a molecular weight of approximately 700.59 g/mol. It has a low solubility in water but is soluble in organic solvents. The compound exhibits good stability under normal laboratory conditions but reacts with strong acids and bases. It is used in various chemical processes due to its reactivity and unique structure.

About

English Name ((1,3,5-Triazine-2,4,6-triyl)tris(benzene-4,1-diyl))triboronic acid
Molecular Formula C21H18B3N3O6
Molecular Weight 440.83 g/mol
SMILES B(C1=CC=C(C=C1)C2=NC(=NC(=N2)C3=CC=C(C=C3)B(O)O)C4=CC=C(C=C4)B(O)O)(O)O
InChIKey IFDYUPUXDOYIOW-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

How is ((1,3,5-Triazine-2,4,6-triyl)tris(benzene-4,1-diyl))triboronic acid (CAS: 910231-21-9) typically synthesized?

((1,3,5-Triazine-2,4,6-triyl)tris(benzene-4,1-diyl))triboronic acid is typically synthesized through...

Compound Q&A

What industries use ((1,3,5-Triazine-2,4,6-triyl)tris(benzene-4,1-diyl))triboronic acid (CAS: 910231-21-9)?

((1,3,5-Triazine-2,4,6-triyl)tris(benzene-4,1-diyl))triboronic acid finds applications in the pharma...

Compound Q&A

What precautions should be taken when handling ((1,3,5-Triazine-2,4,6-triyl)tris(benzene-4,1-diyl))triboronic acid (CAS: 910231-21-9)?

When handling ((1,3,5-Triazine-2,4,6-triyl)tris(benzene-4,1-diyl))triboronic acid, it is important t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...