Compound Q&A

How is ((1,3,5-Triazine-2,4,6-triyl)tris(benzene-4,1-diyl))triboronic acid (CAS: 910231-21-9) typically synthesized?

Answer

((1,3,5-Triazine-2,4,6-triyl)tris(benzene-4,1-diyl))triboronic acid
((1,3,5-Triazine-2,4,6-triyl)tris(benzene-4,1-diyl))triboronic acid is typically synthesized through the boronation of a suitable boronic acid with a triazine derivative. The synthesis involves the use of a mild base and is often carried out in an organic solvent. The process ensures high selectivity and yields, although specific conditions may vary depending on the starting materials.

About

English Name ((1,3,5-Triazine-2,4,6-triyl)tris(benzene-4,1-diyl))triboronic acid
Molecular Formula C21H18B3N3O6
Molecular Weight 440.83 g/mol
SMILES B(C1=CC=C(C=C1)C2=NC(=NC(=N2)C3=CC=C(C=C3)B(O)O)C4=CC=C(C=C4)B(O)O)(O)O
InChIKey IFDYUPUXDOYIOW-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of ((1,3,5-Triazine-2,4,6-triyl)tris(benzene-4,1-diyl))triboronic acid (CAS: 910231-21-9)?

((1,3,5-Triazine-2,4,6-triyl)tris(benzene-4,1-diyl))triboronic acid is a crystalline solid with a mo...

Compound Q&A

What industries use ((1,3,5-Triazine-2,4,6-triyl)tris(benzene-4,1-diyl))triboronic acid (CAS: 910231-21-9)?

((1,3,5-Triazine-2,4,6-triyl)tris(benzene-4,1-diyl))triboronic acid finds applications in the pharma...

Compound Q&A

What precautions should be taken when handling ((1,3,5-Triazine-2,4,6-triyl)tris(benzene-4,1-diyl))triboronic acid (CAS: 910231-21-9)?

When handling ((1,3,5-Triazine-2,4,6-triyl)tris(benzene-4,1-diyl))triboronic acid, it is important t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...