Compound Q&A

What precautions should be taken when handling [4-(2-Methyl-2-propanyl)phenoxy]acetyl chloride (CAS: 90734-55-7)?

Answer

[4-(2-Methyl-2-propanyl)phenoxy]acetyl chloride
When handling [4-(2-Methyl-2-propanyl)phenoxy]acetyl chloride (CAS: 90734-55-7), it is crucial to use appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated fume hood to minimize exposure. In case of a spill, follow the guidelines in the safety data sheet (SDS) and clean up using the appropriate absorbent materials. Ensure proper disposal of any waste according to local regulations.

About

CAS No 90734-55-7
English Name [4-(2-Methyl-2-propanyl)phenoxy]acetyl chloride
Molecular Formula C12H15ClO2
Molecular Weight 226.7 g/mol
SMILES CC(C)(C)C1=CC=C(C=C1)OCC(=O)Cl
InChIKey CFTNMBDQWVPSHI-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of [4-(2-Methyl-2-propanyl)phenoxy]acetyl chloride (CAS: 90734-55-7)?

The compound, [4-(2-Methyl-2-propanyl)phenoxy]acetyl chloride (CAS: 90734-55-7), is a white crystall...

Compound Q&A

How is [4-(2-Methyl-2-propanyl)phenoxy]acetyl chloride (CAS: 90734-55-7) typically synthesized?

The compound can be synthesized via the acylation of 2-methyl-2-propanephenoxy with acetyl chloride....

Compound Q&A

What industries use [4-(2-Methyl-2-propanyl)phenoxy]acetyl chloride (CAS: 90734-55-7)?

This compound is primarily used in the pharmaceutical industry for the synthesis of certain pharmace...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...