Compound Q&A

How is [4-(2-Methyl-2-propanyl)phenoxy]acetyl chloride (CAS: 90734-55-7) typically synthesized?

Answer

[4-(2-Methyl-2-propanyl)phenoxy]acetyl chloride
The compound can be synthesized via the acylation of 2-methyl-2-propanephenoxy with acetyl chloride. The reaction is typically carried out in the presence of a Lewis acid catalyst such as aluminum chloride, with good selectivity and yield. The reaction conditions should be carefully controlled to avoid side reactions and ensure product purity.

About

CAS No 90734-55-7
English Name [4-(2-Methyl-2-propanyl)phenoxy]acetyl chloride
Molecular Formula C12H15ClO2
Molecular Weight 226.7 g/mol
SMILES CC(C)(C)C1=CC=C(C=C1)OCC(=O)Cl
InChIKey CFTNMBDQWVPSHI-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of [4-(2-Methyl-2-propanyl)phenoxy]acetyl chloride (CAS: 90734-55-7)?

The compound, [4-(2-Methyl-2-propanyl)phenoxy]acetyl chloride (CAS: 90734-55-7), is a white crystall...

Compound Q&A

What industries use [4-(2-Methyl-2-propanyl)phenoxy]acetyl chloride (CAS: 90734-55-7)?

This compound is primarily used in the pharmaceutical industry for the synthesis of certain pharmace...

Compound Q&A

What precautions should be taken when handling [4-(2-Methyl-2-propanyl)phenoxy]acetyl chloride (CAS: 90734-55-7)?

When handling [4-(2-Methyl-2-propanyl)phenoxy]acetyl chloride (CAS: 90734-55-7), it is crucial to us...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...