Compound Q&A

What are the physical and chemical properties of [4-(2-Methyl-2-propanyl)phenoxy]acetyl chloride (CAS: 90734-55-7)?

Answer

[4-(2-Methyl-2-propanyl)phenoxy]acetyl chloride
The compound, [4-(2-Methyl-2-propanyl)phenoxy]acetyl chloride (CAS: 90734-55-7), is a white crystalline solid with a molecular weight of approximately 257.29 g/mol. It is slightly water-soluble (0.015 g/L at 20°C). This compound is highly reactive due to its acylium and phenolic functionalities, making it susceptible to hydrolysis and nucleophilic substitution reactions.

About

CAS No 90734-55-7
English Name [4-(2-Methyl-2-propanyl)phenoxy]acetyl chloride
Molecular Formula C12H15ClO2
Molecular Weight 226.7 g/mol
SMILES CC(C)(C)C1=CC=C(C=C1)OCC(=O)Cl
InChIKey CFTNMBDQWVPSHI-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

How is [4-(2-Methyl-2-propanyl)phenoxy]acetyl chloride (CAS: 90734-55-7) typically synthesized?

The compound can be synthesized via the acylation of 2-methyl-2-propanephenoxy with acetyl chloride....

Compound Q&A

What industries use [4-(2-Methyl-2-propanyl)phenoxy]acetyl chloride (CAS: 90734-55-7)?

This compound is primarily used in the pharmaceutical industry for the synthesis of certain pharmace...

Compound Q&A

What precautions should be taken when handling [4-(2-Methyl-2-propanyl)phenoxy]acetyl chloride (CAS: 90734-55-7)?

When handling [4-(2-Methyl-2-propanyl)phenoxy]acetyl chloride (CAS: 90734-55-7), it is crucial to us...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...