Compound Q&A

What industries use 1-[2-(4-Morpholinyl)ethyl]-3-(4-{(2E)-3-[6-(4-morpholinyl)-2-pyridinyl]-2-propenoyl}phenyl)urea (CAS: 867164-40-7)?

Answer

1-[2-(4-Morpholinyl)ethyl]-3-(4-{(2E)-3-[6-(4-morpholinyl)-2-pyridinyl]-2-propenoyl}phenyl)urea
This compound is primarily used in the pharmaceutical industry as an intermediate for drug synthesis. It also finds applications in the production of certain polymers and as a chemical sensor material due to its unique reactivity and functional groups. Its utility in semiconductors is less common but is explored in specialized research contexts.

About

English Name 1-[2-(4-Morpholinyl)ethyl]-3-(4-{(2E)-3-[6-(4-morpholinyl)-2-pyridinyl]-2-propenoyl}phenyl)urea
Molecular Formula C25H31N5O4
Molecular Weight 465.55 g/mol
SMILES O=C(NCCN1CCOCC1)NC1=CC=C(C=C1)C(=O)C=CC1=NC(=CC=C1)N1CCOCC1
InChIKey SQTSPANZQDCPLB-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-[2-(4-Morpholinyl)ethyl]-3-(4-{(2E)-3-[6-(4-morpholinyl)-2-pyridinyl]-2-propenoyl}phenyl)urea (CAS: 867164-40-7)?

The compound is a crystalline solid with a molecular weight of approximately 679.77 g/mol. It has a ...

Compound Q&A

How is 1-[2-(4-Morpholinyl)ethyl]-3-(4-{(2E)-3-[6-(4-morpholinyl)-2-pyridinyl]-2-propenoyl}phenyl)urea (CAS: 867164-40-7) typically synthesized?

This compound is typically synthesized via a multistep process involving the reaction of 2-(4-morpho...

Compound Q&A

What precautions should be taken when handling 1-[2-(4-Morpholinyl)ethyl]-3-(4-{(2E)-3-[6-(4-morpholinyl)-2-pyridinyl]-2-propenoyl}phenyl)urea (CAS: 867164-40-7)?

When handling this compound, it is essential to use appropriate personal protective equipment (PPE),...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...