Compound Q&A

What are the physical and chemical properties of 1-[2-(4-Morpholinyl)ethyl]-3-(4-{(2E)-3-[6-(4-morpholinyl)-2-pyridinyl]-2-propenoyl}phenyl)urea (CAS: 867164-40-7)?

Answer

1-[2-(4-Morpholinyl)ethyl]-3-(4-{(2E)-3-[6-(4-morpholinyl)-2-pyridinyl]-2-propenoyl}phenyl)urea
The compound is a crystalline solid with a molecular weight of approximately 679.77 g/mol. It has a pKa of about 8.5 in aqueous solution. The compound is moderately soluble in water and ethanol. Chemically, it is reactive towards bases and readily undergoes hydrolysis. It is stable under normal storage conditions but should be protected from moisture and strong acids.

About

English Name 1-[2-(4-Morpholinyl)ethyl]-3-(4-{(2E)-3-[6-(4-morpholinyl)-2-pyridinyl]-2-propenoyl}phenyl)urea
Molecular Formula C25H31N5O4
Molecular Weight 465.55 g/mol
SMILES O=C(NCCN1CCOCC1)NC1=CC=C(C=C1)C(=O)C=CC1=NC(=CC=C1)N1CCOCC1
InChIKey SQTSPANZQDCPLB-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

How is 1-[2-(4-Morpholinyl)ethyl]-3-(4-{(2E)-3-[6-(4-morpholinyl)-2-pyridinyl]-2-propenoyl}phenyl)urea (CAS: 867164-40-7) typically synthesized?

This compound is typically synthesized via a multistep process involving the reaction of 2-(4-morpho...

Compound Q&A

What industries use 1-[2-(4-Morpholinyl)ethyl]-3-(4-{(2E)-3-[6-(4-morpholinyl)-2-pyridinyl]-2-propenoyl}phenyl)urea (CAS: 867164-40-7)?

This compound is primarily used in the pharmaceutical industry as an intermediate for drug synthesis...

Compound Q&A

What precautions should be taken when handling 1-[2-(4-Morpholinyl)ethyl]-3-(4-{(2E)-3-[6-(4-morpholinyl)-2-pyridinyl]-2-propenoyl}phenyl)urea (CAS: 867164-40-7)?

When handling this compound, it is essential to use appropriate personal protective equipment (PPE),...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...