Compound Q&A

What precautions should be taken when handling 3-(5-Chloro-2-phenoxyphenyl)-1-methyl-2,4-pyrrolidinedione (CAS: 1162120-35-5)?

Answer

3-(5-Chloro-2-phenoxyphenyl)-1-methyl-2,4-pyrrolidinedione
When handling 3-(5-Chloro-2-phenoxyphenyl)-1-methyl-2,4-pyrrolidinedione, it is crucial to use appropriate personal protective equipment (PPE) such as gloves, lab coat, and safety goggles. This compound should be stored in a cool, dry place away from direct sunlight and heat sources. In case of a spill, it is recommended to use absorbent materials and handle with care to avoid skin contact. It is essential to consult the safety data sheet (SDS) for detailed emergency procedures and storage recommendations.

About

English Name 3-(5-Chloro-2-phenoxyphenyl)-1-methyl-2,4-pyrrolidinedione
Molecular Formula C17H14ClNO3
Molecular Weight 315.76 g/mol
SMILES CN1CC(=O)C(C1=O)c2cc(ccc2Oc3ccccc3)Cl
InChIKey LAXTYFZLKJOGDP-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(5-Chloro-2-phenoxyphenyl)-1-methyl-2,4-pyrrolidinedione (CAS: 1162120-35-5)?

3-(5-Chloro-2-phenoxyphenyl)-1-methyl-2,4-pyrrolidinedione is a crystalline compound with a molecula...

Compound Q&A

How is 3-(5-Chloro-2-phenoxyphenyl)-1-methyl-2,4-pyrrolidinedione (CAS: 1162120-35-5) typically synthesized?

3-(5-Chloro-2-phenoxyphenyl)-1-methyl-2,4-pyrrolidinedione can be synthesized through a multi-step p...

Compound Q&A

What industries use 3-(5-Chloro-2-phenoxyphenyl)-1-methyl-2,4-pyrrolidinedione (CAS: 1162120-35-5)?

3-(5-Chloro-2-phenoxyphenyl)-1-methyl-2,4-pyrrolidinedione finds applications in various industries....

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...