Compound Q&A

What industries use 3-(5-Chloro-2-phenoxyphenyl)-1-methyl-2,4-pyrrolidinedione (CAS: 1162120-35-5)?

Answer

3-(5-Chloro-2-phenoxyphenyl)-1-methyl-2,4-pyrrolidinedione
3-(5-Chloro-2-phenoxyphenyl)-1-methyl-2,4-pyrrolidinedione finds applications in various industries. It is predominantly used in pharmaceuticals for its potential anti-inflammatory and analgesic properties. Additionally, it is used in the development of sensor technologies and as a precursor in the synthesis of other compounds. Its use in polymers and semiconductors is also being explored due to its chemical structure and reactivity.

About

English Name 3-(5-Chloro-2-phenoxyphenyl)-1-methyl-2,4-pyrrolidinedione
Molecular Formula C17H14ClNO3
Molecular Weight 315.76 g/mol
SMILES CN1CC(=O)C(C1=O)c2cc(ccc2Oc3ccccc3)Cl
InChIKey LAXTYFZLKJOGDP-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(5-Chloro-2-phenoxyphenyl)-1-methyl-2,4-pyrrolidinedione (CAS: 1162120-35-5)?

3-(5-Chloro-2-phenoxyphenyl)-1-methyl-2,4-pyrrolidinedione is a crystalline compound with a molecula...

Compound Q&A

How is 3-(5-Chloro-2-phenoxyphenyl)-1-methyl-2,4-pyrrolidinedione (CAS: 1162120-35-5) typically synthesized?

3-(5-Chloro-2-phenoxyphenyl)-1-methyl-2,4-pyrrolidinedione can be synthesized through a multi-step p...

Compound Q&A

What precautions should be taken when handling 3-(5-Chloro-2-phenoxyphenyl)-1-methyl-2,4-pyrrolidinedione (CAS: 1162120-35-5)?

When handling 3-(5-Chloro-2-phenoxyphenyl)-1-methyl-2,4-pyrrolidinedione, it is crucial to use appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...