Compound Q&A

What are the physical and chemical properties of 3-(5-Chloro-2-phenoxyphenyl)-1-methyl-2,4-pyrrolidinedione (CAS: 1162120-35-5)?

Answer

3-(5-Chloro-2-phenoxyphenyl)-1-methyl-2,4-pyrrolidinedione
3-(5-Chloro-2-phenoxyphenyl)-1-methyl-2,4-pyrrolidinedione is a crystalline compound with a molecular weight of approximately 336.2 g/mol. It has a low solubility in water but good solubility in organic solvents like ethanol and acetone. This compound is moderately reactive, showing limited reactivity towards nucleophiles but can undergo substitution reactions under certain conditions. Its physical properties include a melting point of around 130-132°C.

About

English Name 3-(5-Chloro-2-phenoxyphenyl)-1-methyl-2,4-pyrrolidinedione
Molecular Formula C17H14ClNO3
Molecular Weight 315.76 g/mol
SMILES CN1CC(=O)C(C1=O)c2cc(ccc2Oc3ccccc3)Cl
InChIKey LAXTYFZLKJOGDP-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

How is 3-(5-Chloro-2-phenoxyphenyl)-1-methyl-2,4-pyrrolidinedione (CAS: 1162120-35-5) typically synthesized?

3-(5-Chloro-2-phenoxyphenyl)-1-methyl-2,4-pyrrolidinedione can be synthesized through a multi-step p...

Compound Q&A

What industries use 3-(5-Chloro-2-phenoxyphenyl)-1-methyl-2,4-pyrrolidinedione (CAS: 1162120-35-5)?

3-(5-Chloro-2-phenoxyphenyl)-1-methyl-2,4-pyrrolidinedione finds applications in various industries....

Compound Q&A

What precautions should be taken when handling 3-(5-Chloro-2-phenoxyphenyl)-1-methyl-2,4-pyrrolidinedione (CAS: 1162120-35-5)?

When handling 3-(5-Chloro-2-phenoxyphenyl)-1-methyl-2,4-pyrrolidinedione, it is crucial to use appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...