Compound Q&A

What precautions should be taken when handling 3-Iodo-4-isopropylbenzoic acid (CAS: 99059-64-0)?

Answer

3-Iodo-4-isopropylbenzoic acid
When handling 3-Iodo-4-isopropylbenzoic acid, appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat should be worn. The compound should be handled in a well-ventilated area or a fume hood due to potential fumes. In case of a spill, it should be carefully cleaned up using appropriate absorbent materials and disposed of according to local regulations. Always consult the Material Safety Data Sheet (MSDS) and follow all safety guidelines.

About

CAS No 99059-64-0
English Name 3-Iodo-4-isopropylbenzoic acid
Molecular Formula C10H11IO2
Molecular Weight 290.1 g/mol
SMILES CC(C)C1=C(C=C(C=C1)C(=O)O)I
InChIKey YKYRHJJXCOILPA-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Iodo-4-isopropylbenzoic acid (CAS: 99059-64-0)?

3-Iodo-4-isopropylbenzoic acid is a crystalline solid with a molecular weight of approximately 319.0...

Compound Q&A

How is 3-Iodo-4-isopropylbenzoic acid (CAS: 99059-64-0) typically synthesized?

3-Iodo-4-isopropylbenzoic acid is commonly synthesized through alkylation of 4-isopropylbenzoic acid...

Compound Q&A

What industries use 3-Iodo-4-isopropylbenzoic acid (CAS: 99059-64-0)?

3-Iodo-4-isopropylbenzoic acid is utilized in pharmaceuticals for the synthesis of certain drug comp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...