Compound Q&A

How is 3-Iodo-4-isopropylbenzoic acid (CAS: 99059-64-0) typically synthesized?

Answer

3-Iodo-4-isopropylbenzoic acid
3-Iodo-4-isopropylbenzoic acid is commonly synthesized through alkylation of 4-isopropylbenzoic acid with iodomethane, followed by iodination of the resulting product using sodium iodide in the presence of a base like sodium hydroxide. The reaction is typically carried out in a solvent such as dimethylformamide (DMF) at room temperature. The product is isolated by crystallization and recrystallization to obtain high purity.

About

CAS No 99059-64-0
English Name 3-Iodo-4-isopropylbenzoic acid
Molecular Formula C10H11IO2
Molecular Weight 290.1 g/mol
SMILES CC(C)C1=C(C=C(C=C1)C(=O)O)I
InChIKey YKYRHJJXCOILPA-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Iodo-4-isopropylbenzoic acid (CAS: 99059-64-0)?

3-Iodo-4-isopropylbenzoic acid is a crystalline solid with a molecular weight of approximately 319.0...

Compound Q&A

What industries use 3-Iodo-4-isopropylbenzoic acid (CAS: 99059-64-0)?

3-Iodo-4-isopropylbenzoic acid is utilized in pharmaceuticals for the synthesis of certain drug comp...

Compound Q&A

What precautions should be taken when handling 3-Iodo-4-isopropylbenzoic acid (CAS: 99059-64-0)?

When handling 3-Iodo-4-isopropylbenzoic acid, appropriate personal protective equipment (PPE) such a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...