Compound Q&A

What are the physical and chemical properties of 3-Iodo-4-isopropylbenzoic acid (CAS: 99059-64-0)?

Answer

3-Iodo-4-isopropylbenzoic acid
3-Iodo-4-isopropylbenzoic acid is a crystalline solid with a molecular weight of approximately 319.04 g/mol. It is slightly soluble in water and has good solubility in organic solvents like ethanol and acetone. The compound is reactive, particularly towards nucleophilic substitution reactions at the iodine atom and carboxylic acid group. It exhibits good stability under normal conditions but should be stored in a dry place to prevent hydrolysis.

About

CAS No 99059-64-0
English Name 3-Iodo-4-isopropylbenzoic acid
Molecular Formula C10H11IO2
Molecular Weight 290.1 g/mol
SMILES CC(C)C1=C(C=C(C=C1)C(=O)O)I
InChIKey YKYRHJJXCOILPA-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

How is 3-Iodo-4-isopropylbenzoic acid (CAS: 99059-64-0) typically synthesized?

3-Iodo-4-isopropylbenzoic acid is commonly synthesized through alkylation of 4-isopropylbenzoic acid...

Compound Q&A

What industries use 3-Iodo-4-isopropylbenzoic acid (CAS: 99059-64-0)?

3-Iodo-4-isopropylbenzoic acid is utilized in pharmaceuticals for the synthesis of certain drug comp...

Compound Q&A

What precautions should be taken when handling 3-Iodo-4-isopropylbenzoic acid (CAS: 99059-64-0)?

When handling 3-Iodo-4-isopropylbenzoic acid, appropriate personal protective equipment (PPE) such a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...