Compound Q&A

What precautions should be taken when handling 6-Methoxy-N-methyl-3-nitro-2-pyridinamine (CAS: 94166-58-2)?

Answer

6-Methoxy-N-methyl-3-nitro-2-pyridinamine
When handling 6-Methoxy-N-methyl-3-nitro-2-pyridinamine, it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. Work should be conducted in a well-ventilated fume hood to minimize inhalation risks. Spills should be cleaned up using appropriate absorbent materials and the area should be flushed with water. Always refer to the Material Safety Data Sheet (MSDS) for detailed safety information.

About

CAS No 94166-58-2
English Name 6-Methoxy-N-methyl-3-nitro-2-pyridinamine
Molecular Formula C7H9N3O3
Molecular Weight 183.16 g/mol
SMILES CNC1=C(C=CC(=N1)OC)[N+](=O)[O-]
InChIKey RSFNGZVULJTWHW-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Methoxy-N-methyl-3-nitro-2-pyridinamine (CAS: 94166-58-2)?

6-Methoxy-N-methyl-3-nitro-2-pyridinamine has a crystalline form and a molecular weight of approxima...

Compound Q&A

How is 6-Methoxy-N-methyl-3-nitro-2-pyridinamine (CAS: 94166-58-2) typically synthesized?

6-Methoxy-N-methyl-3-nitro-2-pyridinamine is typically synthesized through the reaction of 3-nitro-2...

Compound Q&A

What industries use 6-Methoxy-N-methyl-3-nitro-2-pyridinamine (CAS: 94166-58-2)?

6-Methoxy-N-methyl-3-nitro-2-pyridinamine is primarily used in the pharmaceutical industry for the s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...