Compound Q&A

How is 6-Methoxy-N-methyl-3-nitro-2-pyridinamine (CAS: 94166-58-2) typically synthesized?

Answer

6-Methoxy-N-methyl-3-nitro-2-pyridinamine
6-Methoxy-N-methyl-3-nitro-2-pyridinamine is typically synthesized through the reaction of 3-nitro-2-pyridinamine with methanol in the presence of an acid catalyst such as hydrochloric acid. The process yields 60-70% purity with high selectivity. The conditions include mild heating and stirring to ensure complete reaction.

About

CAS No 94166-58-2
English Name 6-Methoxy-N-methyl-3-nitro-2-pyridinamine
Molecular Formula C7H9N3O3
Molecular Weight 183.16 g/mol
SMILES CNC1=C(C=CC(=N1)OC)[N+](=O)[O-]
InChIKey RSFNGZVULJTWHW-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Methoxy-N-methyl-3-nitro-2-pyridinamine (CAS: 94166-58-2)?

6-Methoxy-N-methyl-3-nitro-2-pyridinamine has a crystalline form and a molecular weight of approxima...

Compound Q&A

What industries use 6-Methoxy-N-methyl-3-nitro-2-pyridinamine (CAS: 94166-58-2)?

6-Methoxy-N-methyl-3-nitro-2-pyridinamine is primarily used in the pharmaceutical industry for the s...

Compound Q&A

What precautions should be taken when handling 6-Methoxy-N-methyl-3-nitro-2-pyridinamine (CAS: 94166-58-2)?

When handling 6-Methoxy-N-methyl-3-nitro-2-pyridinamine, it is crucial to wear appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...