Compound Q&A

What industries use 6-Methoxy-N-methyl-3-nitro-2-pyridinamine (CAS: 94166-58-2)?

Answer

6-Methoxy-N-methyl-3-nitro-2-pyridinamine
6-Methoxy-N-methyl-3-nitro-2-pyridinamine is primarily used in the pharmaceutical industry for the synthesis of various compounds. It is also utilized in the polymer industry for the development of functional materials and in the sensor and semiconductor industries for specific applications such as gas detection and electronic devices.

About

CAS No 94166-58-2
English Name 6-Methoxy-N-methyl-3-nitro-2-pyridinamine
Molecular Formula C7H9N3O3
Molecular Weight 183.16 g/mol
SMILES CNC1=C(C=CC(=N1)OC)[N+](=O)[O-]
InChIKey RSFNGZVULJTWHW-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Methoxy-N-methyl-3-nitro-2-pyridinamine (CAS: 94166-58-2)?

6-Methoxy-N-methyl-3-nitro-2-pyridinamine has a crystalline form and a molecular weight of approxima...

Compound Q&A

How is 6-Methoxy-N-methyl-3-nitro-2-pyridinamine (CAS: 94166-58-2) typically synthesized?

6-Methoxy-N-methyl-3-nitro-2-pyridinamine is typically synthesized through the reaction of 3-nitro-2...

Compound Q&A

What precautions should be taken when handling 6-Methoxy-N-methyl-3-nitro-2-pyridinamine (CAS: 94166-58-2)?

When handling 6-Methoxy-N-methyl-3-nitro-2-pyridinamine, it is crucial to wear appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...