Compound Q&A

What industries use 4-Chloro-1-methyl-3-nitro-2(1H)-quinolinone (CAS: 79966-13-5)?

Answer

4-Chloro-1-methyl-3-nitro-2(1H)-quinolinone
4-Chloro-1-methyl-3-nitro-2(1H)-quinolinone is primarily used in the pharmaceutical industry as an intermediate in the synthesis of certain drugs. It is also utilized in the production of dyes and pigments due to its color properties. Additionally, it has potential applications in the polymer industry, where it can act as a curing agent or stabilizer.

About

CAS No 79966-13-5
English Name 4-Chloro-1-methyl-3-nitro-2(1H)-quinolinone
Molecular Formula C10H7ClN2O3
Molecular Weight 238.63 g/mol
SMILES CN1C2=CC=CC=C2C(=C(C1=O)[N+](=O)[O-])Cl
InChIKey KPDOVJBEKCRATD-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Chloro-1-methyl-3-nitro-2(1H)-quinolinone (CAS: 79966-13-5)?

4-Chloro-1-methyl-3-nitro-2(1H)-quinolinone is a crystalline solid with a molecular weight of approx...

Compound Q&A

How is 4-Chloro-1-methyl-3-nitro-2(1H)-quinolinone (CAS: 79966-13-5) typically synthesized?

4-Chloro-1-methyl-3-nitro-2(1H)-quinolinone is typically synthesized through a multi-step process in...

Compound Q&A

What precautions should be taken when handling 4-Chloro-1-methyl-3-nitro-2(1H)-quinolinone (CAS: 79966-13-5)?

When handling 4-Chloro-1-methyl-3-nitro-2(1H)-quinolinone, it is essential to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...