Compound Q&A

What are the physical and chemical properties of 4-Chloro-1-methyl-3-nitro-2(1H)-quinolinone (CAS: 79966-13-5)?

Answer

4-Chloro-1-methyl-3-nitro-2(1H)-quinolinone
4-Chloro-1-methyl-3-nitro-2(1H)-quinolinone is a crystalline solid with a molecular weight of approximately 265.02 g/mol. It is slightly soluble in water and more soluble in organic solvents like ethanol and acetone. The compound shows moderate reactivity towards reducing agents and is susceptible to hydrolysis under basic conditions. It is stable under normal storage conditions but should be handled with caution due to its potential to react with moisture and air.

About

CAS No 79966-13-5
English Name 4-Chloro-1-methyl-3-nitro-2(1H)-quinolinone
Molecular Formula C10H7ClN2O3
Molecular Weight 238.63 g/mol
SMILES CN1C2=CC=CC=C2C(=C(C1=O)[N+](=O)[O-])Cl
InChIKey KPDOVJBEKCRATD-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

How is 4-Chloro-1-methyl-3-nitro-2(1H)-quinolinone (CAS: 79966-13-5) typically synthesized?

4-Chloro-1-methyl-3-nitro-2(1H)-quinolinone is typically synthesized through a multi-step process in...

Compound Q&A

What industries use 4-Chloro-1-methyl-3-nitro-2(1H)-quinolinone (CAS: 79966-13-5)?

4-Chloro-1-methyl-3-nitro-2(1H)-quinolinone is primarily used in the pharmaceutical industry as an i...

Compound Q&A

What precautions should be taken when handling 4-Chloro-1-methyl-3-nitro-2(1H)-quinolinone (CAS: 79966-13-5)?

When handling 4-Chloro-1-methyl-3-nitro-2(1H)-quinolinone, it is essential to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...