Compound Q&A

How is 4-Chloro-1-methyl-3-nitro-2(1H)-quinolinone (CAS: 79966-13-5) typically synthesized?

Answer

4-Chloro-1-methyl-3-nitro-2(1H)-quinolinone
4-Chloro-1-methyl-3-nitro-2(1H)-quinolinone is typically synthesized through a multi-step process involving the nitration of 1-methyl-2(1H)-quinolinone followed by chlorination. The nitration step usually employs nitric acid in the presence of sulfuric acid as a catalyst, while the chlorination step uses chlorine gas or thionyl chloride. The overall process is exothermic and requires careful temperature control to ensure selectivity and yield.

About

CAS No 79966-13-5
English Name 4-Chloro-1-methyl-3-nitro-2(1H)-quinolinone
Molecular Formula C10H7ClN2O3
Molecular Weight 238.63 g/mol
SMILES CN1C2=CC=CC=C2C(=C(C1=O)[N+](=O)[O-])Cl
InChIKey KPDOVJBEKCRATD-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Chloro-1-methyl-3-nitro-2(1H)-quinolinone (CAS: 79966-13-5)?

4-Chloro-1-methyl-3-nitro-2(1H)-quinolinone is a crystalline solid with a molecular weight of approx...

Compound Q&A

What industries use 4-Chloro-1-methyl-3-nitro-2(1H)-quinolinone (CAS: 79966-13-5)?

4-Chloro-1-methyl-3-nitro-2(1H)-quinolinone is primarily used in the pharmaceutical industry as an i...

Compound Q&A

What precautions should be taken when handling 4-Chloro-1-methyl-3-nitro-2(1H)-quinolinone (CAS: 79966-13-5)?

When handling 4-Chloro-1-methyl-3-nitro-2(1H)-quinolinone, it is essential to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...