Compound Q&A

What industries use 9,9'-Spirobi[fluorene]-2,2'-diamine (CAS: 67665-45-6)?

Answer

9,9'-Spirobi[fluorene]-2,2'-diamine
9,9'-Spirobi[fluorene]-2,2'-diamine (CAS: 67665-45-6) is widely used in the pharmaceutical, polymer, and semiconductor industries. In pharmaceuticals, it serves as a precursor for organic light-emitting diodes (OLEDs) and photovoltaic materials. In polymers, it is used to develop high-performance conjugated polymers for electronic devices. Additionally, it finds applications in sensor technology, where its ability to modulate optical properties makes it valuable for various sensing applications.

About

CAS No 67665-45-6
English Name 9,9'-Spirobi[fluorene]-2,2'-diamine
Molecular Formula C25H18N2
Molecular Weight 346.43 g/mol
SMILES C1=CC=C2C(=C1)C3=C(C24C5=CC=CC=C5C6=C4C=C(C=C6)N)C=C(C=C3)N
InChIKey GXXFPQGHCPOFSD-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 9,9'-Spirobi[fluorene]-2,2'-diamine (CAS: 67665-45-6)?

9,9'-Spirobi[fluorene]-2,2'-diamine (CAS: 67665-45-6) is a colorless solid with a molecular weight o...

Compound Q&A

How is 9,9'-Spirobi[fluorene]-2,2'-diamine (CAS: 67665-45-6) typically synthesized?

9,9'-Spirobi[fluorene]-2,2'-diamine (CAS: 67665-45-6) is synthesized via a multistep process involvi...

Compound Q&A

What precautions should be taken when handling 9,9'-Spirobi[fluorene]-2,2'-diamine (CAS: 67665-45-6)?

When handling 9,9'-Spirobi[fluorene]-2,2'-diamine (CAS: 67665-45-6), it is essential to use personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...