Compound Q&A

What are the physical and chemical properties of 9,9'-Spirobi[fluorene]-2,2'-diamine (CAS: 67665-45-6)?

Answer

9,9'-Spirobi[fluorene]-2,2'-diamine
9,9'-Spirobi[fluorene]-2,2'-diamine (CAS: 67665-45-6) is a colorless solid with a molecular weight of approximately 218.22 g/mol. It has a crystalline form and good solubility in organic solvents such as dimethylformamide (DMF) and dimethyl sulfoxide (DMSO). This compound is known for its stability and limited reactivity under normal conditions. It is often used in the synthesis of conjugated polymers and as a building block in various chemical applications.

About

CAS No 67665-45-6
English Name 9,9'-Spirobi[fluorene]-2,2'-diamine
Molecular Formula C25H18N2
Molecular Weight 346.43 g/mol
SMILES C1=CC=C2C(=C1)C3=C(C24C5=CC=CC=C5C6=C4C=C(C=C6)N)C=C(C=C3)N
InChIKey GXXFPQGHCPOFSD-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

How is 9,9'-Spirobi[fluorene]-2,2'-diamine (CAS: 67665-45-6) typically synthesized?

9,9'-Spirobi[fluorene]-2,2'-diamine (CAS: 67665-45-6) is synthesized via a multistep process involvi...

Compound Q&A

What industries use 9,9'-Spirobi[fluorene]-2,2'-diamine (CAS: 67665-45-6)?

9,9'-Spirobi[fluorene]-2,2'-diamine (CAS: 67665-45-6) is widely used in the pharmaceutical, polymer,...

Compound Q&A

What precautions should be taken when handling 9,9'-Spirobi[fluorene]-2,2'-diamine (CAS: 67665-45-6)?

When handling 9,9'-Spirobi[fluorene]-2,2'-diamine (CAS: 67665-45-6), it is essential to use personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...