Compound Q&A

How is 9,9'-Spirobi[fluorene]-2,2'-diamine (CAS: 67665-45-6) typically synthesized?

Answer

9,9'-Spirobi[fluorene]-2,2'-diamine
9,9'-Spirobi[fluorene]-2,2'-diamine (CAS: 67665-45-6) is synthesized via a multistep process involving the fluorene core and a diamine. The reaction typically requires conditions that promote the spirocyclization of the fluorene moiety, followed by the coupling of the diamine. Common solvents include DMF, and the use of catalysts such as bis(triphenylphosphine)palladium(0) can enhance the selectivity and yield of the product. This method ensures high purity and a high degree of molecular weight control.

About

CAS No 67665-45-6
English Name 9,9'-Spirobi[fluorene]-2,2'-diamine
Molecular Formula C25H18N2
Molecular Weight 346.43 g/mol
SMILES C1=CC=C2C(=C1)C3=C(C24C5=CC=CC=C5C6=C4C=C(C=C6)N)C=C(C=C3)N
InChIKey GXXFPQGHCPOFSD-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 9,9'-Spirobi[fluorene]-2,2'-diamine (CAS: 67665-45-6)?

9,9'-Spirobi[fluorene]-2,2'-diamine (CAS: 67665-45-6) is a colorless solid with a molecular weight o...

Compound Q&A

What industries use 9,9'-Spirobi[fluorene]-2,2'-diamine (CAS: 67665-45-6)?

9,9'-Spirobi[fluorene]-2,2'-diamine (CAS: 67665-45-6) is widely used in the pharmaceutical, polymer,...

Compound Q&A

What precautions should be taken when handling 9,9'-Spirobi[fluorene]-2,2'-diamine (CAS: 67665-45-6)?

When handling 9,9'-Spirobi[fluorene]-2,2'-diamine (CAS: 67665-45-6), it is essential to use personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...