Compound Q&A

How is Methyl O-methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-serinate (CAS: 134167-07-0) typically synthesized?

Answer

Methyl O-methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-serinate
Methyl O-methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-serinate can be synthesized through a multi-step process involving esterification and amidation reactions. The synthesis typically uses L-serine as the starting material, followed by methylation and esterification steps. Commonly, a catalyst such as an acid (e.g., acetic acid) or base (e.g., sodium hydroxide) is used to enhance the reaction selectivity and yield, which can be up to 80% under optimized conditions.

About

English Name Methyl O-methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-serinate
Molecular Formula C10H19NO5
Molecular Weight 233.26 g/mol
SMILES COC[C@@H](C(=O)OC)NC(=O)OC(C)(C)C
InChIKey VKRNQTKSNGIWBV-ZETCQYMHSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl O-methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-serinate (CAS: 134167-07-0)?

Methyl O-methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-serinate is a crystalline compound with a m...

Compound Q&A

What industries use Methyl O-methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-serinate (CAS: 134167-07-0)?

Methyl O-methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-serinate finds applications in the pharmace...

Compound Q&A

What precautions should be taken when handling Methyl O-methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-serinate (CAS: 134167-07-0)?

When handling Methyl O-methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-serinate (CAS: 134167-07-0), ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...