Compound Q&A

What are the physical and chemical properties of Methyl O-methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-serinate (CAS: 134167-07-0)?

Answer

Methyl O-methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-serinate
Methyl O-methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-serinate is a crystalline compound with a molecular weight of approximately 311.34 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. The compound is reactive towards nucleophiles and can undergo esterification and hydrolysis reactions. It typically forms crystalline solids with a melting point around 180-185°C.

About

English Name Methyl O-methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-serinate
Molecular Formula C10H19NO5
Molecular Weight 233.26 g/mol
SMILES COC[C@@H](C(=O)OC)NC(=O)OC(C)(C)C
InChIKey VKRNQTKSNGIWBV-ZETCQYMHSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

How is Methyl O-methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-serinate (CAS: 134167-07-0) typically synthesized?

Methyl O-methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-serinate can be synthesized through a multi...

Compound Q&A

What industries use Methyl O-methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-serinate (CAS: 134167-07-0)?

Methyl O-methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-serinate finds applications in the pharmace...

Compound Q&A

What precautions should be taken when handling Methyl O-methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-serinate (CAS: 134167-07-0)?

When handling Methyl O-methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-serinate (CAS: 134167-07-0), ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...