Compound Q&A

What industries use Luteolin 7-diglucuronide (CAS: 96400-45-2)?

Answer

Luteolin 7-diglucuronide
Luteolin 7-diglucuronide is utilized in the pharmaceutical industry for its potential anti-inflammatory and antioxidant properties. It is also used in the development of biosensors and other analytical tools due to its chemical reactivity. Additionally, it is explored in the food industry for its potential health benefits and as a natural pigment.

About

CAS No 96400-45-2
English Name Luteolin 7-diglucuronide
Molecular Formula C27H26O18
Molecular Weight 638.49 g/mol
SMILES C1=CC(=C(C=C1C2=CC(=O)C3=C(C=C(C=C3O2)OC4C(C(C(C(O4)C(=O)O)O)O)OC5C(C(C(C(O5)C(=O)O)O)O)O)O)O)O
InChIKey PBBVWJQPAZYQDB-DBFWEQBMSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

What are the physical and chemical properties of Luteolin 7-diglucuronide (CAS: 96400-45-2)?

Luteolin 7-diglucuronide is a yellow crystalline solid with a molecular weight of approximately 582....

Compound Q&A

How is Luteolin 7-diglucuronide (CAS: 96400-45-2) typically synthesized?

Luteolin 7-diglucuronide is usually synthesized through the glucuronidation of luteolin in the prese...

Compound Q&A

What precautions should be taken when handling Luteolin 7-diglucuronide (CAS: 96400-45-2)?

When handling Luteolin 7-diglucuronide, it is important to wear appropriate personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...