Compound Q&A

How is Luteolin 7-diglucuronide (CAS: 96400-45-2) typically synthesized?

Answer

Luteolin 7-diglucuronide
Luteolin 7-diglucuronide is usually synthesized through the glucuronidation of luteolin in the presence of glucuronosyltransferase enzymes. The reaction typically involves the use of uridine diphosphate-glucuronic acid (UDPGA) as the donor substrate. The synthetic process is selective and yields high purity products, making it suitable for pharmaceutical and research applications.

About

CAS No 96400-45-2
English Name Luteolin 7-diglucuronide
Molecular Formula C27H26O18
Molecular Weight 638.49 g/mol
SMILES C1=CC(=C(C=C1C2=CC(=O)C3=C(C=C(C=C3O2)OC4C(C(C(C(O4)C(=O)O)O)O)OC5C(C(C(C(O5)C(=O)O)O)O)O)O)O)O
InChIKey PBBVWJQPAZYQDB-DBFWEQBMSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

What are the physical and chemical properties of Luteolin 7-diglucuronide (CAS: 96400-45-2)?

Luteolin 7-diglucuronide is a yellow crystalline solid with a molecular weight of approximately 582....

Compound Q&A

What industries use Luteolin 7-diglucuronide (CAS: 96400-45-2)?

Luteolin 7-diglucuronide is utilized in the pharmaceutical industry for its potential anti-inflammat...

Compound Q&A

What precautions should be taken when handling Luteolin 7-diglucuronide (CAS: 96400-45-2)?

When handling Luteolin 7-diglucuronide, it is important to wear appropriate personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...