Compound Q&A

What are the physical and chemical properties of Luteolin 7-diglucuronide (CAS: 96400-45-2)?

Answer

Luteolin 7-diglucuronide
Luteolin 7-diglucuronide is a yellow crystalline solid with a molecular weight of approximately 582.2 Da. It has a low solubility in water but is soluble in organic solvents like methanol and ethanol. This compound is relatively stable under normal conditions but may react with bases to form less stable derivatives. It is used in various applications due to its chemical stability and specific reactivity.

About

CAS No 96400-45-2
English Name Luteolin 7-diglucuronide
Molecular Formula C27H26O18
Molecular Weight 638.49 g/mol
SMILES C1=CC(=C(C=C1C2=CC(=O)C3=C(C=C(C=C3O2)OC4C(C(C(C(O4)C(=O)O)O)O)OC5C(C(C(C(O5)C(=O)O)O)O)O)O)O)O
InChIKey PBBVWJQPAZYQDB-DBFWEQBMSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

How is Luteolin 7-diglucuronide (CAS: 96400-45-2) typically synthesized?

Luteolin 7-diglucuronide is usually synthesized through the glucuronidation of luteolin in the prese...

Compound Q&A

What industries use Luteolin 7-diglucuronide (CAS: 96400-45-2)?

Luteolin 7-diglucuronide is utilized in the pharmaceutical industry for its potential anti-inflammat...

Compound Q&A

What precautions should be taken when handling Luteolin 7-diglucuronide (CAS: 96400-45-2)?

When handling Luteolin 7-diglucuronide, it is important to wear appropriate personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...