Compound Q&A

What industries use 2'-Deoxy-2'-fluoro-N2-isobutyrylguanosine (CAS: 80681-25-0)?

Answer

2'-Deoxy-2'-fluoro-N2-isobutyrylguanosine
2'-Deoxy-2'-fluoro-N2-isobutyrylguanosine (CAS: 80681-25-0) is primarily used in the pharmaceutical industry for its potential as an anticancer drug candidate. It is also of interest in the development of nucleic acid-based therapies. Additionally, it may have applications in sensor technology and as a research tool in molecular biology.

About

CAS No 80681-25-0
English Name 2'-Deoxy-2'-fluoro-N2-isobutyrylguanosine
Molecular Formula C14H18FN5O5
Molecular Weight 355.33 g/mol
SMILES OC[C@@H]1[C@H]([C@@H](F)[C@H](N2C=NC3=C2N=C(NC(C(C)C)=O)NC3=O)O1)O
InChIKey SLHADUUWJSVYGQ-HTFXMJNNSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2'-Deoxy-2'-fluoro-N2-isobutyrylguanosine (CAS: 80681-25-0)?

2'-Deoxy-2'-fluoro-N2-isobutyrylguanosine (CAS: 80681-25-0) is a nucleoside derivative. It is a whit...

Compound Q&A

How is 2'-Deoxy-2'-fluoro-N2-isobutyrylguanosine (CAS: 80681-25-0) typically synthesized?

2'-Deoxy-2'-fluoro-N2-isobutyrylguanosine is typically synthesized via a multi-step process involvin...

Compound Q&A

What precautions should be taken when handling 2'-Deoxy-2'-fluoro-N2-isobutyrylguanosine (CAS: 80681-25-0)?

When handling 2'-Deoxy-2'-fluoro-N2-isobutyrylguanosine (CAS: 80681-25-0), ensure the use of Persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...