Compound Q&A

How is 2'-Deoxy-2'-fluoro-N2-isobutyrylguanosine (CAS: 80681-25-0) typically synthesized?

Answer

2'-Deoxy-2'-fluoro-N2-isobutyrylguanosine
2'-Deoxy-2'-fluoro-N2-isobutyrylguanosine is typically synthesized via a multi-step process involving the isobutyrylation of guanosine-2'-phosphate followed by deprotection and fluorination. Commonly used solvents include dichloromethane and acetonitrile. The synthesis involves the use of isobutyryl chloride and hydrogen fluoride as reagents. Yield and selectivity are generally high, with a yield of about 70-80%.

About

CAS No 80681-25-0
English Name 2'-Deoxy-2'-fluoro-N2-isobutyrylguanosine
Molecular Formula C14H18FN5O5
Molecular Weight 355.33 g/mol
SMILES OC[C@@H]1[C@H]([C@@H](F)[C@H](N2C=NC3=C2N=C(NC(C(C)C)=O)NC3=O)O1)O
InChIKey SLHADUUWJSVYGQ-HTFXMJNNSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2'-Deoxy-2'-fluoro-N2-isobutyrylguanosine (CAS: 80681-25-0)?

2'-Deoxy-2'-fluoro-N2-isobutyrylguanosine (CAS: 80681-25-0) is a nucleoside derivative. It is a whit...

Compound Q&A

What industries use 2'-Deoxy-2'-fluoro-N2-isobutyrylguanosine (CAS: 80681-25-0)?

2'-Deoxy-2'-fluoro-N2-isobutyrylguanosine (CAS: 80681-25-0) is primarily used in the pharmaceutical ...

Compound Q&A

What precautions should be taken when handling 2'-Deoxy-2'-fluoro-N2-isobutyrylguanosine (CAS: 80681-25-0)?

When handling 2'-Deoxy-2'-fluoro-N2-isobutyrylguanosine (CAS: 80681-25-0), ensure the use of Persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...