Compound Q&A

What industries use 4-(3-Fluorophenyl)piperidine hydrochloride (CAS: 104774-94-9)?

Answer

4-(3-Fluorophenyl)piperidine hydrochloride (1:1)
4-(3-Fluorophenyl)piperidine hydrochloride is primarily used in the pharmaceutical industry for the development of new drugs. It is also used in the polymer industry as a monomer or additive. Additionally, it has applications in the production of sensors and semiconductors due to its unique chemical properties.

About

English Name 4-(3-Fluorophenyl)piperidine hydrochloride (1:1)
Molecular Formula C11H15ClFN
Molecular Weight 215.7 g/mol
SMILES C1CNCCC1C2=CC(=CC=C2)F.Cl
InChIKey KZWKZINPPPZZCE-UHFFFAOYSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(3-Fluorophenyl)piperidine hydrochloride (CAS: 104774-94-9)?

4-(3-Fluorophenyl)piperidine hydrochloride is a white crystalline solid with a molecular weight of 2...

Compound Q&A

How is 4-(3-Fluorophenyl)piperidine hydrochloride (CAS: 104774-94-9) typically synthesized?

4-(3-Fluorophenyl)piperidine hydrochloride is typically synthesized via a multi-step process involvi...

Compound Q&A

What precautions should be taken when handling 4-(3-Fluorophenyl)piperidine hydrochloride (CAS: 104774-94-9)?

When handling 4-(3-Fluorophenyl)piperidine hydrochloride, it is crucial to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...