Compound Q&A

What are the physical and chemical properties of 4-(3-Fluorophenyl)piperidine hydrochloride (CAS: 104774-94-9)?

Answer

4-(3-Fluorophenyl)piperidine hydrochloride (1:1)
4-(3-Fluorophenyl)piperidine hydrochloride is a white crystalline solid with a molecular weight of 260.71 g/mol. It has a pKa of approximately 1.3 and is highly soluble in water and less soluble in organic solvents like methanol and ethyl acetate. It is moderately reactive with bases and can undergo hydrolysis under basic conditions. It is often used in pharmaceutical applications due to its stability and solubility properties.

About

English Name 4-(3-Fluorophenyl)piperidine hydrochloride (1:1)
Molecular Formula C11H15ClFN
Molecular Weight 215.7 g/mol
SMILES C1CNCCC1C2=CC(=CC=C2)F.Cl
InChIKey KZWKZINPPPZZCE-UHFFFAOYSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

How is 4-(3-Fluorophenyl)piperidine hydrochloride (CAS: 104774-94-9) typically synthesized?

4-(3-Fluorophenyl)piperidine hydrochloride is typically synthesized via a multi-step process involvi...

Compound Q&A

What industries use 4-(3-Fluorophenyl)piperidine hydrochloride (CAS: 104774-94-9)?

4-(3-Fluorophenyl)piperidine hydrochloride is primarily used in the pharmaceutical industry for the ...

Compound Q&A

What precautions should be taken when handling 4-(3-Fluorophenyl)piperidine hydrochloride (CAS: 104774-94-9)?

When handling 4-(3-Fluorophenyl)piperidine hydrochloride, it is crucial to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...