Compound Q&A

What precautions should be taken when handling phenyl trifluoromethyl sulfone (CAS: 426-58-4)?

Answer

Phenyl trifluoromethyl sulfone
When handling phenyl trifluoromethyl sulfone (CAS: 426-58-4), it is essential to wear appropriate personal protective equipment (PPE) such as safety goggles, gloves, and lab coat. Work should be conducted in a well-ventilated area or a fume hood to minimize inhalation risk. Spills should be handled carefully using appropriate absorbent materials, and the area should be thoroughly cleaned. Always consult the Material Safety Data Sheet (MSDS) for detailed safety information and follow all safety guidelines.

About

CAS No 426-58-4
English Name Phenyl trifluoromethyl sulfone
Molecular Formula C7H5F3O2S
Molecular Weight 210.18 g/mol
SMILES C1=CC=C(C=C1)S(=O)(=O)C(F)(F)F
InChIKey UPGBQYFXKAKWQC-UHFFFAOYSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

What are the physical and chemical properties of Phenyl trifluoromethyl sulfone (CAS: 426-58-4)?

Phenyl trifluoromethyl sulfone (CAS: 426-58-4) is a colorless to light yellow liquid with a molecula...

Compound Q&A

How is phenyl trifluoromethyl sulfone (CAS: 426-58-4) typically synthesized?

Phenyl trifluoromethyl sulfone (CAS: 426-58-4) is typically synthesized via a substitution reaction ...

Compound Q&A

What industries use phenyl trifluoromethyl sulfone (CAS: 426-58-4)?

Phenyl trifluoromethyl sulfone (CAS: 426-58-4) is used in various industries such as pharmaceuticals...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...