Compound Q&A

What are the physical and chemical properties of Phenyl trifluoromethyl sulfone (CAS: 426-58-4)?

Answer

Phenyl trifluoromethyl sulfone
Phenyl trifluoromethyl sulfone (CAS: 426-58-4) is a colorless to light yellow liquid with a molecular weight of 222.07 g/mol. It has a high boiling point and is poorly soluble in water but readily soluble in organic solvents. The compound is stable under normal conditions but can react with strong bases. It is often used in organic synthesis due to its reactivity and stability under certain conditions.

About

CAS No 426-58-4
English Name Phenyl trifluoromethyl sulfone
Molecular Formula C7H5F3O2S
Molecular Weight 210.18 g/mol
SMILES C1=CC=C(C=C1)S(=O)(=O)C(F)(F)F
InChIKey UPGBQYFXKAKWQC-UHFFFAOYSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

How is phenyl trifluoromethyl sulfone (CAS: 426-58-4) typically synthesized?

Phenyl trifluoromethyl sulfone (CAS: 426-58-4) is typically synthesized via a substitution reaction ...

Compound Q&A

What industries use phenyl trifluoromethyl sulfone (CAS: 426-58-4)?

Phenyl trifluoromethyl sulfone (CAS: 426-58-4) is used in various industries such as pharmaceuticals...

Compound Q&A

What precautions should be taken when handling phenyl trifluoromethyl sulfone (CAS: 426-58-4)?

When handling phenyl trifluoromethyl sulfone (CAS: 426-58-4), it is essential to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...