Compound Q&A

How is phenyl trifluoromethyl sulfone (CAS: 426-58-4) typically synthesized?

Answer

Phenyl trifluoromethyl sulfone
Phenyl trifluoromethyl sulfone (CAS: 426-58-4) is typically synthesized via a substitution reaction where trifluoromethyl sulfone (CF3SO2O) reacts with phenol (C6H5OH) in the presence of a base catalyst such as potassium carbonate (K2CO3) or sodium hydride (NaH). The yield and selectivity of the reaction can be improved by optimizing reaction conditions, including temperature and solvent choice.

About

CAS No 426-58-4
English Name Phenyl trifluoromethyl sulfone
Molecular Formula C7H5F3O2S
Molecular Weight 210.18 g/mol
SMILES C1=CC=C(C=C1)S(=O)(=O)C(F)(F)F
InChIKey UPGBQYFXKAKWQC-UHFFFAOYSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

What are the physical and chemical properties of Phenyl trifluoromethyl sulfone (CAS: 426-58-4)?

Phenyl trifluoromethyl sulfone (CAS: 426-58-4) is a colorless to light yellow liquid with a molecula...

Compound Q&A

What industries use phenyl trifluoromethyl sulfone (CAS: 426-58-4)?

Phenyl trifluoromethyl sulfone (CAS: 426-58-4) is used in various industries such as pharmaceuticals...

Compound Q&A

What precautions should be taken when handling phenyl trifluoromethyl sulfone (CAS: 426-58-4)?

When handling phenyl trifluoromethyl sulfone (CAS: 426-58-4), it is essential to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...