Compound Q&A

What industries use 4-Methyl-2-oxo-2H-chromen-7-yl 6-deoxy-alpha-L-galactopyranoside (CAS: 54322-38-2)?

Answer

4-Methyl-2-oxo-2H-chromen-7-yl 6-deoxy-alpha-L-galactopyranoside
4-Methyl-2-oxo-2H-chromen-7-yl 6-deoxy-alpha-L-galactopyranoside finds use in the pharmaceutical industry for the development of new drug candidates and in the polymer industry for the synthesis of biodegradable polymers. It is also explored in sensor technology for its unique optical properties.

About

CAS No 54322-38-2
English Name 4-Methyl-2-oxo-2H-chromen-7-yl 6-deoxy-alpha-L-galactopyranoside
Molecular Formula C16H18O7
Molecular Weight 322.31 g/mol
SMILES CC1C(C(C(C(O1)OC2=CC3=C(C=C2)C(=CC(=O)O3)C)O)O)O
InChIKey CQKHENXHLAUMBH-CRLRYRHBSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Methyl-2-oxo-2H-chromen-7-yl 6-deoxy-alpha-L-galactopyranoside (CAS: 54322-38-2)?

4-Methyl-2-oxo-2H-chromen-7-yl 6-deoxy-alpha-L-galactopyranoside is a crystalline compound with a mo...

Compound Q&A

How is 4-Methyl-2-oxo-2H-chromen-7-yl 6-deoxy-alpha-L-galactopyranoside (CAS: 54322-38-2) typically synthesized?

4-Methyl-2-oxo-2H-chromen-7-yl 6-deoxy-alpha-L-galactopyranoside is typically synthesized via a cond...

Compound Q&A

What precautions should be taken when handling 4-Methyl-2-oxo-2H-chromen-7-yl 6-deoxy-alpha-L-galactopyranoside (CAS: 54322-38-2)?

Proper personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat should be ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...