Compound Q&A

How is 4-Methyl-2-oxo-2H-chromen-7-yl 6-deoxy-alpha-L-galactopyranoside (CAS: 54322-38-2) typically synthesized?

Answer

4-Methyl-2-oxo-2H-chromen-7-yl 6-deoxy-alpha-L-galactopyranoside
4-Methyl-2-oxo-2H-chromen-7-yl 6-deoxy-alpha-L-galactopyranoside is typically synthesized via a condensation reaction of 4-methyl-2-oxo-2H-chromen-7-yl chloride and 6-deoxy-alpha-L-galactopyranosyl chloride in the presence of a catalyst such as 4-dimethylaminopyridine (DMAP). The reaction yields up to 90% of the desired product, with high structural selectivity.

About

CAS No 54322-38-2
English Name 4-Methyl-2-oxo-2H-chromen-7-yl 6-deoxy-alpha-L-galactopyranoside
Molecular Formula C16H18O7
Molecular Weight 322.31 g/mol
SMILES CC1C(C(C(C(O1)OC2=CC3=C(C=C2)C(=CC(=O)O3)C)O)O)O
InChIKey CQKHENXHLAUMBH-CRLRYRHBSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Methyl-2-oxo-2H-chromen-7-yl 6-deoxy-alpha-L-galactopyranoside (CAS: 54322-38-2)?

4-Methyl-2-oxo-2H-chromen-7-yl 6-deoxy-alpha-L-galactopyranoside is a crystalline compound with a mo...

Compound Q&A

What industries use 4-Methyl-2-oxo-2H-chromen-7-yl 6-deoxy-alpha-L-galactopyranoside (CAS: 54322-38-2)?

4-Methyl-2-oxo-2H-chromen-7-yl 6-deoxy-alpha-L-galactopyranoside finds use in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling 4-Methyl-2-oxo-2H-chromen-7-yl 6-deoxy-alpha-L-galactopyranoside (CAS: 54322-38-2)?

Proper personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat should be ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...