Compound Q&A

What are the physical and chemical properties of 4-Methyl-2-oxo-2H-chromen-7-yl 6-deoxy-alpha-L-galactopyranoside (CAS: 54322-38-2)?

Answer

4-Methyl-2-oxo-2H-chromen-7-yl 6-deoxy-alpha-L-galactopyranoside
4-Methyl-2-oxo-2H-chromen-7-yl 6-deoxy-alpha-L-galactopyranoside is a crystalline compound with a molecular weight of approximately 312.24 g/mol. It has a melting point around 220-222°C and is poorly soluble in water but soluble in organic solvents like ethanol and acetone. It reacts readily with acids and bases. This compound is stable under normal conditions but may decompose at high temperatures.

About

CAS No 54322-38-2
English Name 4-Methyl-2-oxo-2H-chromen-7-yl 6-deoxy-alpha-L-galactopyranoside
Molecular Formula C16H18O7
Molecular Weight 322.31 g/mol
SMILES CC1C(C(C(C(O1)OC2=CC3=C(C=C2)C(=CC(=O)O3)C)O)O)O
InChIKey CQKHENXHLAUMBH-CRLRYRHBSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

How is 4-Methyl-2-oxo-2H-chromen-7-yl 6-deoxy-alpha-L-galactopyranoside (CAS: 54322-38-2) typically synthesized?

4-Methyl-2-oxo-2H-chromen-7-yl 6-deoxy-alpha-L-galactopyranoside is typically synthesized via a cond...

Compound Q&A

What industries use 4-Methyl-2-oxo-2H-chromen-7-yl 6-deoxy-alpha-L-galactopyranoside (CAS: 54322-38-2)?

4-Methyl-2-oxo-2H-chromen-7-yl 6-deoxy-alpha-L-galactopyranoside finds use in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling 4-Methyl-2-oxo-2H-chromen-7-yl 6-deoxy-alpha-L-galactopyranoside (CAS: 54322-38-2)?

Proper personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat should be ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...