Compound Q&A

What precautions should be taken when handling Avatrombopag Impurity 8 (CAS: 570407-42-0)?

Answer

Avatrombopag Impurity 8
When handling Avatrombopag Impurity 8, it is essential to use appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. Work should be conducted in a well-ventilated fume hood to minimize inhalation risks. Spills should be cleaned up immediately using appropriate absorbents and waste should be disposed of according to local regulations. Always consult the Safety Data Sheet (SDS) for detailed information on handling and storage.

About

English Name Avatrombopag Impurity 8
Molecular Formula C17H23ClN4S2
Molecular Weight 382.97 g/mol
SMILES Nc1nc(-c2cc(Cl)cs2)c(N2CCN(C3CCCCC3)CC2)s1
InChIKey FQQOPZRSAIEOGH-UHFFFAOYSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

What are the physical and chemical properties of Avatrombopag Impurity 8 (CAS: 570407-42-0)?

Avatrombopag Impurity 8 is a crystalline solid with a molecular weight of approximately 419.45 g/mol...

Compound Q&A

How is Avatrombopag Impurity 8 (CAS: 570407-42-0) typically synthesized?

Avatrombopag Impurity 8 is synthesized through a multi-step process involving Friedel-Crafts alkylat...

Compound Q&A

What industries use Avatrombopag Impurity 8 (CAS: 570407-42-0)?

Avatrombopag Impurity 8 is primarily used in the pharmaceutical industry, where it is a by-product o...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...