Compound Q&A

What are the physical and chemical properties of Avatrombopag Impurity 8 (CAS: 570407-42-0)?

Answer

Avatrombopag Impurity 8
Avatrombopag Impurity 8 is a crystalline solid with a molecular weight of approximately 419.45 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetonitrile. The impurity is chemically reactive and can undergo ring-opening reactions under basic conditions. It is less stable compared to the parent compound, making it important to store under an inert atmosphere to prevent degradation.

About

English Name Avatrombopag Impurity 8
Molecular Formula C17H23ClN4S2
Molecular Weight 382.97 g/mol
SMILES Nc1nc(-c2cc(Cl)cs2)c(N2CCN(C3CCCCC3)CC2)s1
InChIKey FQQOPZRSAIEOGH-UHFFFAOYSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

How is Avatrombopag Impurity 8 (CAS: 570407-42-0) typically synthesized?

Avatrombopag Impurity 8 is synthesized through a multi-step process involving Friedel-Crafts alkylat...

Compound Q&A

What industries use Avatrombopag Impurity 8 (CAS: 570407-42-0)?

Avatrombopag Impurity 8 is primarily used in the pharmaceutical industry, where it is a by-product o...

Compound Q&A

What precautions should be taken when handling Avatrombopag Impurity 8 (CAS: 570407-42-0)?

When handling Avatrombopag Impurity 8, it is essential to use appropriate personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...