Compound Q&A

What industries use Avatrombopag Impurity 8 (CAS: 570407-42-0)?

Answer

Avatrombopag Impurity 8
Avatrombopag Impurity 8 is primarily used in the pharmaceutical industry, where it is a by-product or impurity in the synthesis of the antifibrinolytic agent avatrombopag. It plays a role in pharmacokinetic and safety studies of the parent drug. Additionally, it may be used in research and development for drug metabolism and toxicity studies.

About

English Name Avatrombopag Impurity 8
Molecular Formula C17H23ClN4S2
Molecular Weight 382.97 g/mol
SMILES Nc1nc(-c2cc(Cl)cs2)c(N2CCN(C3CCCCC3)CC2)s1
InChIKey FQQOPZRSAIEOGH-UHFFFAOYSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

What are the physical and chemical properties of Avatrombopag Impurity 8 (CAS: 570407-42-0)?

Avatrombopag Impurity 8 is a crystalline solid with a molecular weight of approximately 419.45 g/mol...

Compound Q&A

How is Avatrombopag Impurity 8 (CAS: 570407-42-0) typically synthesized?

Avatrombopag Impurity 8 is synthesized through a multi-step process involving Friedel-Crafts alkylat...

Compound Q&A

What precautions should be taken when handling Avatrombopag Impurity 8 (CAS: 570407-42-0)?

When handling Avatrombopag Impurity 8, it is essential to use appropriate personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...