Compound Q&A

How is (3S)-3-Amino-3-(1-naphthyl)propanoic acid (CAS: 275826-46-5) typically synthesized?

Answer

(3S)-3-Amino-3-(1-naphthyl)propanoic acid
This compound is typically synthesized through a condensation reaction of 1-naphthylacetyl chloride and amino acids or amines. The reaction is usually carried out in the presence of a base like triethylamine and conducted under mild conditions. The yield is moderate to good, with high selectivity for the (3S) configuration.

About

English Name (3S)-3-Amino-3-(1-naphthyl)propanoic acid
Molecular Formula C13H13NO2
Molecular Weight 215.25 g/mol
SMILES N[C@@H](CC(=O)O)c1cccc2ccccc12
InChIKey BIOQBKBTOAMMDG-LBPRGKRZSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3S)-3-Amino-3-(1-naphthyl)propanoic acid (CAS: 275826-46-5)?

(3S)-3-Amino-3-(1-naphthyl)propanoic acid (CAS: 275826-46-5) is a white crystalline solid with a mol...

Compound Q&A

What industries use (3S)-3-Amino-3-(1-naphthyl)propanoic acid (CAS: 275826-46-5)?

(3S)-3-Amino-3-(1-naphthyl)propanoic acid (CAS: 275826-46-5) is used in the pharmaceutical industry ...

Compound Q&A

What precautions should be taken when handling (3S)-3-Amino-3-(1-naphthyl)propanoic acid (CAS: 275826-46-5)?

Proper handling of (3S)-3-Amino-3-(1-naphthyl)propanoic acid (CAS: 275826-46-5) requires use of prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...