Compound Q&A

What are the physical and chemical properties of (3S)-3-Amino-3-(1-naphthyl)propanoic acid (CAS: 275826-46-5)?

Answer

(3S)-3-Amino-3-(1-naphthyl)propanoic acid
(3S)-3-Amino-3-(1-naphthyl)propanoic acid (CAS: 275826-46-5) is a white crystalline solid with a molecular weight of approximately 264.26 g/mol. It is slightly soluble in water and ethanol. The compound exhibits basic reactivity due to the amino group. It is highly stable under neutral conditions but can hydrolyze under acidic or basic conditions.

About

English Name (3S)-3-Amino-3-(1-naphthyl)propanoic acid
Molecular Formula C13H13NO2
Molecular Weight 215.25 g/mol
SMILES N[C@@H](CC(=O)O)c1cccc2ccccc12
InChIKey BIOQBKBTOAMMDG-LBPRGKRZSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

How is (3S)-3-Amino-3-(1-naphthyl)propanoic acid (CAS: 275826-46-5) typically synthesized?

This compound is typically synthesized through a condensation reaction of 1-naphthylacetyl chloride ...

Compound Q&A

What industries use (3S)-3-Amino-3-(1-naphthyl)propanoic acid (CAS: 275826-46-5)?

(3S)-3-Amino-3-(1-naphthyl)propanoic acid (CAS: 275826-46-5) is used in the pharmaceutical industry ...

Compound Q&A

What precautions should be taken when handling (3S)-3-Amino-3-(1-naphthyl)propanoic acid (CAS: 275826-46-5)?

Proper handling of (3S)-3-Amino-3-(1-naphthyl)propanoic acid (CAS: 275826-46-5) requires use of prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...