Compound Q&A

What industries use (6-(4-Methylpiperazin-1-yl)pyridin-3-yl)boronic acid (CAS: 936353-84-3)?

Answer

(6-(4-Methylpiperazin-1-yl)pyridin-3-yl)boronic acid
(6-(4-Methylpiperazin-1-yl)pyridin-3-yl)boronic acid finds applications in pharmaceuticals, where it serves as a building block for drug synthesis. It is also used in the development of sensors due to its chemoresponsive properties. Additionally, it has potential in the synthesis of polymers and semiconductors, although its primary application is in pharmaceutical research and development.

About

English Name (6-(4-Methylpiperazin-1-yl)pyridin-3-yl)boronic acid
Molecular Formula C10H16BN3O2
Molecular Weight 221.07 g/mol
SMILES B(C1=CN=C(C=C1)N2CCN(CC2)C)(O)O
InChIKey YGZOCDXCJWHNQN-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of (6-(4-Methylpiperazin-1-yl)pyridin-3-yl)boronic acid (CAS: 936353-84-3)?

(6-(4-Methylpiperazin-1-yl)pyridin-3-yl)boronic acid is a white crystalline solid with a molecular w...

Compound Q&A

How is (6-(4-Methylpiperazin-1-yl)pyridin-3-yl)boronic acid (CAS: 936353-84-3) typically synthesized?

(6-(4-Methylpiperazin-1-yl)pyridin-3-yl)boronic acid is typically synthesized via a multistep proces...

Compound Q&A

What precautions should be taken when handling (6-(4-Methylpiperazin-1-yl)pyridin-3-yl)boronic acid (CAS: 936353-84-3)?

When handling (6-(4-Methylpiperazin-1-yl)pyridin-3-yl)boronic acid, it is essential to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...