Compound Q&A

What are the physical and chemical properties of (6-(4-Methylpiperazin-1-yl)pyridin-3-yl)boronic acid (CAS: 936353-84-3)?

Answer

(6-(4-Methylpiperazin-1-yl)pyridin-3-yl)boronic acid
(6-(4-Methylpiperazin-1-yl)pyridin-3-yl)boronic acid is a white crystalline solid with a molecular weight of approximately 315.33 g/mol. It is slightly soluble in water but more soluble in organic solvents like ethanol and acetonitrile. This compound is reactive towards nucleophiles and can undergo boronate ester formation under mild conditions. It has good stability in neutral and slightly acidic conditions but should be handled in inert atmospheres to avoid oxidation.

About

English Name (6-(4-Methylpiperazin-1-yl)pyridin-3-yl)boronic acid
Molecular Formula C10H16BN3O2
Molecular Weight 221.07 g/mol
SMILES B(C1=CN=C(C=C1)N2CCN(CC2)C)(O)O
InChIKey YGZOCDXCJWHNQN-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:33

Related Q&A

Compound Q&A

How is (6-(4-Methylpiperazin-1-yl)pyridin-3-yl)boronic acid (CAS: 936353-84-3) typically synthesized?

(6-(4-Methylpiperazin-1-yl)pyridin-3-yl)boronic acid is typically synthesized via a multistep proces...

Compound Q&A

What industries use (6-(4-Methylpiperazin-1-yl)pyridin-3-yl)boronic acid (CAS: 936353-84-3)?

(6-(4-Methylpiperazin-1-yl)pyridin-3-yl)boronic acid finds applications in pharmaceuticals, where it...

Compound Q&A

What precautions should be taken when handling (6-(4-Methylpiperazin-1-yl)pyridin-3-yl)boronic acid (CAS: 936353-84-3)?

When handling (6-(4-Methylpiperazin-1-yl)pyridin-3-yl)boronic acid, it is essential to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...