Compound Q&A

How is (6-(4-Methylpiperazin-1-yl)pyridin-3-yl)boronic acid (CAS: 936353-84-3) typically synthesized?

Answer

(6-(4-Methylpiperazin-1-yl)pyridin-3-yl)boronic acid
(6-(4-Methylpiperazin-1-yl)pyridin-3-yl)boronic acid is typically synthesized via a multistep process involving the preparation of 4-methylpiperazin-1-yl derivative and subsequent coupling with 3-pyridylboronic acid. The synthesis usually requires the use of a palladium catalyst, such as Pd(PPh3)4, and a base like triethylamine. The yield is generally around 70-80%, with excellent selectivity towards the boronic ester formation.

About

English Name (6-(4-Methylpiperazin-1-yl)pyridin-3-yl)boronic acid
Molecular Formula C10H16BN3O2
Molecular Weight 221.07 g/mol
SMILES B(C1=CN=C(C=C1)N2CCN(CC2)C)(O)O
InChIKey YGZOCDXCJWHNQN-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of (6-(4-Methylpiperazin-1-yl)pyridin-3-yl)boronic acid (CAS: 936353-84-3)?

(6-(4-Methylpiperazin-1-yl)pyridin-3-yl)boronic acid is a white crystalline solid with a molecular w...

Compound Q&A

What industries use (6-(4-Methylpiperazin-1-yl)pyridin-3-yl)boronic acid (CAS: 936353-84-3)?

(6-(4-Methylpiperazin-1-yl)pyridin-3-yl)boronic acid finds applications in pharmaceuticals, where it...

Compound Q&A

What precautions should be taken when handling (6-(4-Methylpiperazin-1-yl)pyridin-3-yl)boronic acid (CAS: 936353-84-3)?

When handling (6-(4-Methylpiperazin-1-yl)pyridin-3-yl)boronic acid, it is essential to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...