Compound Q&A

What are the physical and chemical properties of 4-Bromo-2-phenylpyridine (CAS: 98420-98-5)?

Answer

4-Bromo-2-phenylpyridine
4-Bromo-2-phenylpyridine is a crystalline solid with a molecular weight of approximately 247.02 g/mol. It has a low water solubility but is soluble in common organic solvents such as ethanol and dichloromethane. It is moderately reactive with nucleophiles and can undergo substitution reactions. The compound is stable under normal conditions but requires careful handling in the presence of strong reducing agents.

About

CAS No 98420-98-5
English Name 4-Bromo-2-phenylpyridine
Molecular Formula C11H8BrN
Molecular Weight 234.1 g/mol
SMILES C1=CC=C(C=C1)C2=NC=CC(=C2)Br
InChIKey HCQHVQSQHXZRGA-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:33

Related Q&A

Compound Q&A

How is 4-Bromo-2-phenylpyridine (CAS: 98420-98-5) typically synthesized?

4-Bromo-2-phenylpyridine is typically synthesized via the bromination of 2-phenylpyridine. This proc...

Compound Q&A

What industries use 4-Bromo-2-phenylpyridine (CAS: 98420-98-5)?

4-Bromo-2-phenylpyridine is used in the pharmaceutical industry for the synthesis of certain drug in...

Compound Q&A

What precautions should be taken when handling 4-Bromo-2-phenylpyridine (CAS: 98420-98-5)?

When handling 4-Bromo-2-phenylpyridine, it is essential to use personal protective equipment (PPE) s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...