Compound Q&A

What industries use 2-Chloro-7-nitroquinoxaline (CAS: 55686-94-7)?

Answer

2-Chloro-7-nitroquinoxaline
2-Chloro-7-nitroquinoxaline has applications in the pharmaceutical industry, where it serves as a precursor for synthesizing various drugs. It is also used in the sensor industry for the development of gas sensors and in the semiconductor industry for specific applications related to doping or as a precursor material.

About

CAS No 55686-94-7
English Name 2-Chloro-7-nitroquinoxaline
Molecular Formula C8H4ClN3O2
Molecular Weight 209.59 g/mol
SMILES [O-][N+](=O)c1ccc2ncc(Cl)nc2c1
InChIKey DCWHGXURAAYUEC-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chloro-7-nitroquinoxaline (CAS: 55686-94-7)?

2-Chloro-7-nitroquinoxaline is a crystalline solid with a molecular weight of approximately 244.59 g...

Compound Q&A

How is 2-Chloro-7-nitroquinoxaline (CAS: 55686-94-7) typically synthesized?

2-Chloro-7-nitroquinoxaline is typically synthesized by the reaction of 2-aminoquinoxaline with thio...

Compound Q&A

What precautions should be taken when handling 2-Chloro-7-nitroquinoxaline (CAS: 55686-94-7)?

When handling 2-Chloro-7-nitroquinoxaline, it is essential to wear appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...