Compound Q&A

What are the physical and chemical properties of 2-Chloro-7-nitroquinoxaline (CAS: 55686-94-7)?

Answer

2-Chloro-7-nitroquinoxaline
2-Chloro-7-nitroquinoxaline is a crystalline solid with a molecular weight of approximately 244.59 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. The compound is moderately reactive, particularly towards nucleophiles and reducing agents. It is stable under normal storage conditions but should be handled with care to avoid decomposition.

About

CAS No 55686-94-7
English Name 2-Chloro-7-nitroquinoxaline
Molecular Formula C8H4ClN3O2
Molecular Weight 209.59 g/mol
SMILES [O-][N+](=O)c1ccc2ncc(Cl)nc2c1
InChIKey DCWHGXURAAYUEC-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:33

Related Q&A

Compound Q&A

How is 2-Chloro-7-nitroquinoxaline (CAS: 55686-94-7) typically synthesized?

2-Chloro-7-nitroquinoxaline is typically synthesized by the reaction of 2-aminoquinoxaline with thio...

Compound Q&A

What industries use 2-Chloro-7-nitroquinoxaline (CAS: 55686-94-7)?

2-Chloro-7-nitroquinoxaline has applications in the pharmaceutical industry, where it serves as a pr...

Compound Q&A

What precautions should be taken when handling 2-Chloro-7-nitroquinoxaline (CAS: 55686-94-7)?

When handling 2-Chloro-7-nitroquinoxaline, it is essential to wear appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...