Compound Q&A

How is 2-Chloro-7-nitroquinoxaline (CAS: 55686-94-7) typically synthesized?

Answer

2-Chloro-7-nitroquinoxaline
2-Chloro-7-nitroquinoxaline is typically synthesized by the reaction of 2-aminoquinoxaline with thionyl chloride followed by nitration with nitric acid. The reaction involves the introduction of a chlorine atom and a nitro group into the quinoxaline ring. The process requires careful control of reaction conditions to ensure high yield and selectivity.

About

CAS No 55686-94-7
English Name 2-Chloro-7-nitroquinoxaline
Molecular Formula C8H4ClN3O2
Molecular Weight 209.59 g/mol
SMILES [O-][N+](=O)c1ccc2ncc(Cl)nc2c1
InChIKey DCWHGXURAAYUEC-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chloro-7-nitroquinoxaline (CAS: 55686-94-7)?

2-Chloro-7-nitroquinoxaline is a crystalline solid with a molecular weight of approximately 244.59 g...

Compound Q&A

What industries use 2-Chloro-7-nitroquinoxaline (CAS: 55686-94-7)?

2-Chloro-7-nitroquinoxaline has applications in the pharmaceutical industry, where it serves as a pr...

Compound Q&A

What precautions should be taken when handling 2-Chloro-7-nitroquinoxaline (CAS: 55686-94-7)?

When handling 2-Chloro-7-nitroquinoxaline, it is essential to wear appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...