Compound Q&A

What industries use methyl 2-amino-3-(trifluoromethyl)benzoate (CAS: 64321-95-5)?

Answer

Methyl 2-amino-3-(trifluoromethyl)benzoate
Methyl 2-amino-3-(trifluoromethyl)benzoate (CAS: 64321-95-5) is used in various industries, including pharmaceuticals for the synthesis of certain drugs, and in the production of specialized materials such as polymers and sensors. It is also used in the development of semiconductor materials due to its unique structural and chemical properties.

About

CAS No 64321-95-5
English Name Methyl 2-amino-3-(trifluoromethyl)benzoate
Molecular Formula C9H8F3NO2
Molecular Weight 219.16 g/mol
SMILES COC(=O)C1=C(C(=CC=C1)C(F)(F)F)N
InChIKey COTQUWGKILPGMY-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2-amino-3-(trifluoromethyl)benzoate (CAS: 64321-95-5)?

Methyl 2-amino-3-(trifluoromethyl)benzoate (CAS: 64321-95-5) is a crystalline compound with a molecu...

Compound Q&A

How is methyl 2-amino-3-(trifluoromethyl)benzoate (CAS: 64321-95-5) typically synthesized?

Methyl 2-amino-3-(trifluoromethyl)benzoate (CAS: 64321-95-5) is synthesized through the reaction of ...

Compound Q&A

What precautions should be taken when handling methyl 2-amino-3-(trifluoromethyl)benzoate (CAS: 64321-95-5)?

When handling methyl 2-amino-3-(trifluoromethyl)benzoate (CAS: 64321-95-5), it is essential to wear ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...